ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 618-76-8 4-hydroxy-3,5-diiodobenzoic acid | |
| Chemical Name | 4-hydroxy-3,5-diiodobenzoic acid | 
| Synonyms | 3,5-Diiodo-4-hydroxybenzoic acid | 
| Molecular Formula | C7H4I2O3 | 
| Molecular Weight | 389.9138 | 
| InChl | InChI=1/C7H4I2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) | 
| CAS Registry Number | 618-76-8 | 
| EINECS | 210-562-0 | 
| Molecular Structure |  | 
| Density | 2.697g/cm3 | 
| Boiling Point | 346.4°C at 760 mmHg | 
| Refractive Index | 1.784 | 
| Flash Point | 163.3°C | 
| Vapour Pressur | 2.19E-05mmHg at 25°C | 
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; | 
| MSDS | |