659-30-3 4-fluorophenylurea |
| Product Name |
4-fluorophenylurea |
| Synonyms |
Urea, 1-(p-fluorophenyl)-;(4-Fluorophenyl)urea;1-(p-Fluorophenyl)urea;4-12-00-01108 (Beilstein Handbook Reference);BRN 2090131;1-(4-fluorophenyl)urea;1-(4-fluorophenyl)-1H-pyrrole |
| Molecular Formula |
C10H8FN |
| Molecular Weight |
161.1756 |
| InChl |
InChI=1/C10H8FN/c11-9-3-5-10(6-4-9)12-7-1-2-8-12/h1-8H |
| CAS Registry Number |
659-30-3 |
| Molecular Structure |
 |
| Density |
1.07g/cm3 |
| Boiling Point |
229.7°C at 760 mmHg |
| Refractive Index |
1.543 |
| Flash Point |
92.7°C |
| Vapour Pressur |
0.104mmHg at 25°C |
| Safety Description |
S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:;
|
