68049-20-7 5-(3-fluorophenyl)pyrimidine |
|
| Product Name | 5-(3-fluorophenyl)pyrimidine |
| Synonyms | 5-(3-Fluorophenyl)pyrimidine;pyrimidine, 5-(3-fluorophenyl)- |
| Molecular Formula | C10H7FN2 |
| Molecular Weight | 174.1744 |
| InChl | InChI=1/C10H7FN2/c11-10-3-1-2-8(4-10)9-5-12-7-13-6-9/h1-7H |
| CAS Registry Number | 68049-20-7 |
| Molecular Structure |  |
| Density | 1.198g/cm3 |
| Boiling Point | 298.979°C at 760 mmHg |
| Refractive Index | 1.56 |
| Flash Point | 134.618°C |
| Vapour Pressur | 0.002mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
