70362-47-9 2,2',4,5-tetrachlorobiphenyl |
|
| Product Name | 2,2',4,5-tetrachlorobiphenyl |
| Synonyms | 1,1'-Biphenyl, 2,2',4,5-tetrachloro;1,1'-biphenyl, 2,2',4,5-tetrachloro-;2,2',4,5-PCB;70362-47-9 |
| Molecular Formula | C12H6Cl4 |
| Molecular Weight | 291.988 |
| InChl | InChI=1/C12H6Cl4/c13-9-4-2-1-3-7(9)8-5-11(15)12(16)6-10(8)14/h1-6H |
| CAS Registry Number | 70362-47-9 |
| Molecular Structure |  |
| Density | 1.441g/cm3 |
| Boiling Point | 344.8°C at 760 mmHg |
| Refractive Index | 1.612 |
| Flash Point | 161.9°C |
| Vapour Pressur | 0.000128mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
