ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
70421-98-6 3-(1-azabicyclo[2.2.2]oct-2-ylmethyl)-1H-indole hydrochloride |
|
| Chemical Name | 3-(1-azabicyclo[2.2.2]oct-2-ylmethyl)-1H-indole hydrochloride |
| Molecular Formula | C16H21ClN2 |
| Molecular Weight | 276.8043 |
| InChl | InChI=1/C16H20N2.ClH/c1-2-4-16-15(3-1)13(11-17-16)10-14-9-12-5-7-18(14)8-6-12;/h1-4,11-12,14,17H,5-10H2;1H |
| CAS Registry Number | 70421-98-6 |
| Molecular Structure | ![]() |
| Boiling Point | 409.1°C at 760 mmHg |
| Flash Point | 201.2°C |
| Vapour Pressur | 6.66E-07mmHg at 25°C |
| MSDS | |