ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7144-10-7 bis(4-chlorophenyl) benzene-1,2-dicarboxylate |
|
| Chemical Name | bis(4-chlorophenyl) benzene-1,2-dicarboxylate |
| Synonyms | Phthalic acid, di(4-chlorophenyl) ester |
| Molecular Formula | C20H12Cl2O4 |
| Molecular Weight | 387.2129 |
| InChl | InChI=1/C20H12Cl2O4/c21-13-5-9-15(10-6-13)25-19(23)17-3-1-2-4-18(17)20(24)26-16-11-7-14(22)8-12-16/h1-12H |
| CAS Registry Number | 7144-10-7 |
| Molecular Structure | ![]() |
| Density | 1.382g/cm3 |
| Boiling Point | 540.5°C at 760 mmHg |
| Refractive Index | 1.627 |
| Flash Point | 204.9°C |
| Vapour Pressur | 9.48E-12mmHg at 25°C |
| MSDS | |