ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7155-33-1 [2-(3,5-dinitrophenyl)-1-(methoxycarbonyl)-2-oxoethylidene]diazenium |
|
| Chemical Name | [2-(3,5-dinitrophenyl)-1-(methoxycarbonyl)-2-oxoethylidene]diazenium |
| Molecular Formula | C10H7N4O7 |
| Molecular Weight | 295.1846 |
| InChl | InChI=1/C10H7N4O7/c1-21-10(16)8(12-11)9(15)5-2-6(13(17)18)4-7(3-5)14(19)20/h2-4,11H,1H3/q+1 |
| CAS Registry Number | 7155-33-1 |
| Molecular Structure | ![]() |
| MSDS | |