ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
71959-95-0 methyl 3-carboxy-1,4-dimethyl-1H-pyrrole-2-acetate |
|
| Chemical Name | methyl 3-carboxy-1,4-dimethyl-1H-pyrrole-2-acetate |
| Synonyms | Methyl 3-carboxy-1,4-dimethyl-1H-pyrrole-2-acetate;2-(2-methoxy-2-oxo-ethyl)-1,4-dimethyl-pyrrole-3-carboxylic acid |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.2145 |
| InChl | InChI=1/C10H13NO4/c1-6-5-11(2)7(4-8(12)15-3)9(6)10(13)14/h5H,4H2,1-3H3,(H,13,14) |
| CAS Registry Number | 71959-95-0 |
| EINECS | 276-208-2 |
| Molecular Structure | ![]() |
| Density | 1.23g/cm3 |
| Boiling Point | 348.4°C at 760 mmHg |
| Refractive Index | 1.534 |
| Flash Point | 164.5°C |
| Vapour Pressur | 1.9E-05mmHg at 25°C |
| MSDS | |