ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
725-05-3 4'-Methoxybiphenyl-3-carboxylic acid |
|
| Chemical Name | 4'-Methoxybiphenyl-3-carboxylic acid |
| Synonyms | 4'-methoxybiphenyl-3-carboxylate;4'-Methoxy-Biphenyl-3-Carboxylic Acid |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.2433 |
| InChl | InChI=1/C14H12O3/c1-17-13-7-5-10(6-8-13)11-3-2-4-12(9-11)14(15)16/h2-9H,1H3,(H,15,16) |
| CAS Registry Number | 725-05-3 |
| Molecular Structure | ![]() |
| Density | 1.193g/cm3 |
| Boiling Point | 424.6°C at 760 mmHg |
| Refractive Index | 1.589 |
| Flash Point | 164.9°C |
| Vapour Pressur | 5.74E-08mmHg at 25°C |
| MSDS | |