ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72578-17-7 1-(cyclopropylamino)-3-{2-[(E)-2-(5-methyl-1,3,4-thiadiazol-2-yl)ethenyl]phenoxy}propan-2-ol |
|
| Chemical Name | 1-(cyclopropylamino)-3-{2-[(E)-2-(5-methyl-1,3,4-thiadiazol-2-yl)ethenyl]phenoxy}propan-2-ol |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.4325 |
| InChl | InChI=1/C17H21N3O2S/c1-12-19-20-17(23-12)9-6-13-4-2-3-5-16(13)22-11-15(21)10-18-14-7-8-14/h2-6,9,14-15,18,21H,7-8,10-11H2,1H3/b9-6+ |
| CAS Registry Number | 72578-17-7 |
| Molecular Structure | ![]() |
| Density | 1.27g/cm3 |
| Boiling Point | 569.4°C at 760 mmHg |
| Refractive Index | 1.624 |
| Flash Point | 298.2°C |
| Vapour Pressur | 8.33E-14mmHg at 25°C |
| MSDS | |