ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
73038-24-1 prop-2-enoic acid - hexa-1,5-diene-3,4-diol (1:1) |
|
| Chemical Name | prop-2-enoic acid - hexa-1,5-diene-3,4-diol (1:1) |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.2051 |
| InChl | InChI=1/C6H10O2.C3H4O2/c1-3-5(7)6(8)4-2;1-2-3(4)5/h3-8H,1-2H2;2H,1H2,(H,4,5) |
| CAS Registry Number | 73038-24-1 |
| Molecular Structure | ![]() |
| Boiling Point | 201.9°C at 760 mmHg |
| Flash Point | 92.8°C |
| Vapour Pressur | 0.0737mmHg at 25°C |
| MSDS | |