ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7477-14-7 benzene-1,2-diylbis[(4-chlorophenyl)methanone] |
|
| Chemical Name | benzene-1,2-diylbis[(4-chlorophenyl)methanone] |
| Molecular Formula | C20H12Cl2O2 |
| Molecular Weight | 355.2141 |
| InChl | InChI=1/C20H12Cl2O2/c21-15-9-5-13(6-10-15)19(23)17-3-1-2-4-18(17)20(24)14-7-11-16(22)12-8-14/h1-12H |
| CAS Registry Number | 7477-14-7 |
| Molecular Structure | ![]() |
| Density | 1.317g/cm3 |
| Boiling Point | 539°C at 760 mmHg |
| Refractive Index | 1.627 |
| Flash Point | 224.4°C |
| Vapour Pressur | 1.09E-11mmHg at 25°C |
| MSDS | |