ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
75-27-4 Bromodichloromethane |
|
| Chemical Name | Bromodichloromethane |
| Synonyms | FC-20B1 |
| Molecular Formula | CHBrCl2 |
| Molecular Weight | 163.8286 |
| InChl | InChI=1/CHBrCl2/c2-1(3)4/h1H |
| CAS Registry Number | 75-27-4 |
| EINECS | 200-856-7 |
| Molecular Structure | ![]() |
| Density | 2.013g/cm3 |
| Melting Point | -55℃ |
| Boiling Point | 89.7°C at 760 mmHg |
| Refractive Index | 1.503 |
| Flash Point | 1.3°C |
| Vapour Pressur | 65.3mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
| Safety Description | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |