ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
76410-23-6 3-{[3-(ethoxycarbonyl)-2-methylnaphtho[1,2-b]furan-6-yl]oxy}-2-hydroxy-N-(propan-2-yl)propan-1-aminium chloride |
|
| Chemical Name | 3-{[3-(ethoxycarbonyl)-2-methylnaphtho[1,2-b]furan-6-yl]oxy}-2-hydroxy-N-(propan-2-yl)propan-1-aminium chloride |
| Molecular Formula | C22H28ClNO5 |
| Molecular Weight | 421.9144 |
| InChl | InChI=1/C22H27NO5.ClH/c1-5-26-22(25)20-14(4)28-21-17-7-6-8-19(16(17)9-10-18(20)21)27-12-15(24)11-23-13(2)3;/h6-10,13,15,23-24H,5,11-12H2,1-4H3;1H |
| CAS Registry Number | 76410-23-6 |
| Molecular Structure | ![]() |
| Boiling Point | 561.9°C at 760 mmHg |
| Flash Point | 293.6°C |
| Vapour Pressur | 1.84E-13mmHg at 25°C |
| MSDS | |