ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7698-94-4 [1,2,5]selenadiazolo[3,4-d]pyrimidin-7(3H)-one |
|
| Chemical Name | [1,2,5]selenadiazolo[3,4-d]pyrimidin-7(3H)-one |
| Molecular Formula | C4H2N4OSe |
| Molecular Weight | 201.0449 |
| InChl | InChI=1/C4H2N4OSe/c9-4-2-3(5-1-6-4)8-10-7-2/h1H,(H,5,6,8,9) |
| CAS Registry Number | 7698-94-4 |
| Molecular Structure | ![]() |
| Boiling Point | 285.3°C at 760 mmHg |
| Flash Point | 126.3°C |
| Vapour Pressur | 0.00283mmHg at 25°C |
| MSDS | |