ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
77791-37-8 1-(2-{[1-(2,4-dimethylphenoxy)propan-2-yl](ethyl)amino}-2-oxoethyl)-2-methylpiperidinium chloride |
|
| Chemical Name | 1-(2-{[1-(2,4-dimethylphenoxy)propan-2-yl](ethyl)amino}-2-oxoethyl)-2-methylpiperidinium chloride |
| Molecular Formula | C21H35ClN2O2 |
| Molecular Weight | 382.9678 |
| InChl | InChI=1/C21H34N2O2.ClH/c1-6-23(21(24)14-22-12-8-7-9-18(22)4)19(5)15-25-20-11-10-16(2)13-17(20)3;/h10-11,13,18-19H,6-9,12,14-15H2,1-5H3;1H |
| CAS Registry Number | 77791-37-8 |
| Molecular Structure | ![]() |
| Boiling Point | 471.4°C at 760 mmHg |
| Flash Point | 238.9°C |
| Vapour Pressur | 4.66E-09mmHg at 25°C |
| MSDS | |