ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
779-24-8 2-phenyl[1,2,4]triazolo[1,5-a]pyridine |
|
| Chemical Name | 2-phenyl[1,2,4]triazolo[1,5-a]pyridine |
| Synonyms | [1,2,4]Triazolo[1,5-a]pyridine, 2-phenyl- |
| Molecular Formula | C12H9N3 |
| Molecular Weight | 195.22 |
| InChl | InChI=1/C12H9N3/c1-2-6-10(7-3-1)12-13-11-8-4-5-9-15(11)14-12/h1-9H |
| CAS Registry Number | 779-24-8 |
| Molecular Structure | ![]() |
| Density | 1.21g/cm3 |
| Refractive Index | 1.674 |
| MSDS | |