81-50-5 1-amino-4-bromo-2-methylanthraquinone |
|
| Product Name | 1-amino-4-bromo-2-methylanthraquinone |
| Molecular Formula | C15H10BrNO2 |
| Molecular Weight | 316.1494 |
| InChl | InChI=1/C15H10BrNO2/c1-7-6-10(16)11-12(13(7)17)15(19)9-5-3-2-4-8(9)14(11)18/h2-6H,17H2,1H3 |
| CAS Registry Number | 81-50-5 |
| EINECS | 201-355-6 |
| Molecular Structure |  |
| Density | 1.631g/cm3 |
| Melting Point | 235℃ |
| Boiling Point | 526.5°C at 760 mmHg |
| Refractive Index | 1.706 |
| Flash Point | 272.2°C |
| Vapour Pressur | 3.56E-11mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
