ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
81-90-3 α,α-bis(4-hydroxyphenyl)-o-toluic acid |
|
| Chemical Name | α,α-bis(4-hydroxyphenyl)-o-toluic acid |
| Synonyms | Phenolphthalin;2-[bis(4-hydroxyphenyl)methyl]benzoate |
| Molecular Formula | C20H15O4 |
| Molecular Weight | 319.3312 |
| InChl | InChI=1/C20H16O4/c21-15-9-5-13(6-10-15)19(14-7-11-16(22)12-8-14)17-3-1-2-4-18(17)20(23)24/h1-12,19,21-22H,(H,23,24)/p-1 |
| CAS Registry Number | 81-90-3 |
| EINECS | 201-384-4 |
| Molecular Structure | ![]() |
| Boiling Point | 548.7°C at 760 mmHg |
| Flash Point | 299.7°C |
| Vapour Pressur | 7.12E-13mmHg at 25°C |
| MSDS | |