ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
81-95-8 3,3'-thiobis[7H-benz[de]anthracen-7-one] |
|
| Chemical Name | 3,3'-thiobis[7H-benz[de]anthracen-7-one] |
| Synonyms | 7H-Benz(de)anthracen-7-one, 3,3'-thiobis-;3,3'-Thiobis(7H-benz(de)anthracen-7-one);NSC 86170;3,3'-sulfanediylbis(7H-benzo[de]anthracen-7-one) |
| Molecular Formula | C34H18O2S |
| Molecular Weight | 490.5705 |
| InChl | InChI=1/C34H18O2S/c35-33-23-9-3-1-7-19(23)21-15-17-29(25-11-5-13-27(33)31(21)25)37-30-18-16-22-20-8-2-4-10-24(20)34(36)28-14-6-12-26(30)32(22)28/h1-18H |
| CAS Registry Number | 81-95-8 |
| EINECS | 201-389-1 |
| Molecular Structure | ![]() |
| Density | 1.46g/cm3 |
| Boiling Point | 777.9°C at 760 mmHg |
| Refractive Index | 1.848 |
| Flash Point | 328.3°C |
| Vapour Pressur | 3.89E-24mmHg at 25°C |
| MSDS | |