ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-46-2 1,5-Dichloroanthraquinone |
|
| Chemical Name | 1,5-Dichloroanthraquinone |
| Synonyms | 1,5-Dichloranthrachinon;1,5-Dichloranthrachinon [Czech];1,5-Dichloro-9,10-anthraquinone;9,10-Anthracenedione, 1,5-dichloro-;AI3-38301;NSC 13969;Anthraquinone, 1,5-dichloro-;1,5-dichloroanthracene-9,10-dione;1,5-Dichloro Anthraquinone |
| Molecular Formula | C14H6Cl2O2 |
| Molecular Weight | 277.1022 |
| InChl | InChI=1/C14H6Cl2O2/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6H |
| CAS Registry Number | 82-46-2 |
| EINECS | 201-424-0 |
| Molecular Structure | ![]() |
| Density | 1.514g/cm3 |
| Melting Point | 245-250℃ |
| Boiling Point | 455.2°C at 760 mmHg |
| Refractive Index | 1.671 |
| Flash Point | 191.7°C |
| Vapour Pressur | 1.79E-08mmHg at 25°C |
| Safety Description | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |