82-71-3 2,4,6-TRINITRORESORCINOL |
|
| Product Name | 2,4,6-TRINITRORESORCINOL |
| Synonyms | 1,3-Benzenediol, 2,4,6-trinitro-;Styphnic acid;2,4,6-trinitrobenzene-1,3-diol |
| Molecular Formula | C6H3N3O8 |
| Molecular Weight | 245.1 |
| InChl | InChI=1/C6H3N3O8/c10-5-2(7(12)13)1-3(8(14)15)6(11)4(5)9(16)17/h1,10-11H |
| CAS Registry Number | 82-71-3 |
| EINECS | 201-436-6 |
| Molecular Structure |  |
| Density | 2.012g/cm3 |
| Boiling Point | 292.6°C at 760 mmHg |
| Refractive Index | 1.75 |
| Flash Point | 126.8°C |
| Vapour Pressur | 0.00104mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
