ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-31-8 1-naphthol-8-sulf. acid sultone |
|
| Chemical Name | 1-naphthol-8-sulf. acid sultone |
| Synonyms | 1,8-Naphthosultone;naphthalene-1,8-sultone;naphtho[1,8-cd][1,2]oxathiole 2,2-dioxide |
| Molecular Formula | C10H6O3S |
| Molecular Weight | 206.2178 |
| InChl | InChI=1/C10H6O3S/c11-14(12)9-6-2-4-7-3-1-5-8(13-14)10(7)9/h1-6H |
| CAS Registry Number | 83-31-8 |
| EINECS | 201-468-0 |
| Molecular Structure | ![]() |
| Density | 1.556g/cm3 |
| Melting Point | 154-157℃ |
| Boiling Point | 419.524°C at 760 mmHg |
| Refractive Index | 1.729 |
| Flash Point | 207.521°C |
| Vapour Pressur | 0mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R38:; |
| Safety Description | S22||S28:; |
| MSDS | |