ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84787-76-8 dodecyl bis(4-nonylphenyl) phosphite |
|
| Chemical Name | dodecyl bis(4-nonylphenyl) phosphite |
| Synonyms | Dodecyl bis(4-nonylphenyl) phosphite |
| Molecular Formula | C42H71O3P |
| Molecular Weight | 654.9851 |
| InChl | InChI=1/C42H71O3P/c1-4-7-10-13-16-17-18-21-24-27-38-43-46(44-41-34-30-39(31-35-41)28-25-22-19-14-11-8-5-2)45-42-36-32-40(33-37-42)29-26-23-20-15-12-9-6-3/h30-37H,4-29,38H2,1-3H3 |
| CAS Registry Number | 84787-76-8 |
| EINECS | 284-117-4 |
| Molecular Structure | ![]() |
| Boiling Point | 660.5°C at 760 mmHg |
| Flash Point | 445.8°C |
| Vapour Pressur | 1.39E-16mmHg at 25°C |
| MSDS | |