ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-02-9 5,6-Benzoquinoline |
|
| Chemical Name | 5,6-Benzoquinoline |
| Synonyms | beta-Naphthoquinoline;1-Azaphenanthrene;Benzo[f]quinoline;Benzoquinoline;benzo(f)quinoline |
| Molecular Formula | C13H9N |
| Molecular Weight | 179.2173 |
| InChl | InChI=1/C13H9N/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13/h1-9H |
| CAS Registry Number | 85-02-9 |
| EINECS | 201-582-0 |
| Molecular Structure | ![]() |
| Density | 1.187g/cm3 |
| Melting Point | 89-91℃ |
| Boiling Point | 350.4°C at 760 mmHg |
| Refractive Index | 1.726 |
| Flash Point | 155.9°C |
| Vapour Pressur | 8.89E-05mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.||R40##Possible risks of irreversible effects.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |