ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-19-1 naphthol as-sg practical grade |
|
| Chemical Name | naphthol as-sg practical grade |
| Synonyms | 2-hydroxy-4-methoxy-11H-benzo(a)carbazole-3-carboxanilide;Naphthol AS-SG;2-Hydroxy-11-H-benzo-2-Carbazole-3-Carbonyl-P-Anisidine;2-hydroxy-N-(4-methoxyphenyl)-11H-benzo[a]carbazole-3-carboxamide |
| Molecular Formula | C24H18N2O3 |
| Molecular Weight | 382.4113 |
| InChl | InChI=1/C24H18N2O3/c1-29-16-9-7-15(8-10-16)25-24(28)20-12-14-6-11-18-17-4-2-3-5-21(17)26-23(18)19(14)13-22(20)27/h2-13,26-27H,1H3,(H,25,28) |
| CAS Registry Number | 86-19-1 |
| EINECS | 201-654-1 |
| Molecular Structure | ![]() |
| Density | 1.408g/cm3 |
| Boiling Point | 598.6°C at 760 mmHg |
| Refractive Index | 1.812 |
| Flash Point | 315.8°C |
| Vapour Pressur | 6.37E-15mmHg at 25°C |
| MSDS | |