ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-59-8 neoagarohexaitol |
|
| Chemical Name | neoagarohexaitol |
| Synonyms | Benzene, 4-chloro-1-methyl-2-nitro-;2-Nitro-4-chlorotoluene;4-Chloro-2-nitrotoluene;AI3-00494;CCRIS 3116;NSC 5386;p-Chloro-o-nitrotoluene;Benzene, 4-chloro-1-methyl-3-nitro-;Toluene, 4-chloro-2-nitro-;4-chloro-1-methyl-2-nitrobenzene;4-Chloro-2-nitro toluene |
| Molecular Formula | C7H6ClNO2 |
| Molecular Weight | 171.581 |
| InChl | InChI=1/C7H6ClNO2/c1-5-2-3-6(8)4-7(5)9(10)11/h2-4H,1H3 |
| CAS Registry Number | 89-59-8 |
| EINECS | 201-921-2 |
| Molecular Structure | ![]() |
| Density | 1.324g/cm3 |
| Melting Point | 35-37℃ |
| Boiling Point | 238.5°C at 760 mmHg |
| Refractive Index | 1.57 |
| Flash Point | 98.1°C |
| Water Solubility | 109 mg/L (20℃) |
| Vapour Pressur | 0.0651mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R20/21/22||R36/37/38:; |
| Safety Description | S26||S36/37/39:; |
| MSDS | |