ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-82-7 p-menth-4(8)-en-3-one |
|
| Chemical Name | p-menth-4(8)-en-3-one |
| Synonyms | (+)-(R)-Pulegone;(+)-Pulegone;(1R)-(+)-p-Menth-4(8)-en-3-one;(R)-(+)-Pulegone;(R)-Pulegone;3-Methyl-6-isopropylidenecyclohexanone;4(8)-p-Menthen-3-one, delta-;5-Methyl-2-(1-methylethylidene)cyclohexanone, (R)-;AI3-11218;CCRIS 5746;FEMA No. 2963;NSC 15334;Pulegon;Pulegone (natural);Pulegone, d-;d-Pulegone;p-Menth-4(8)-en-3-one, (R)-(+)-;Cyclohexanone, 5-methyl-2-(1-methylethylidene)-, (5R)-;Cyclohexanone, 5-methyl-2-(1-methylethylidene)-, (R)-;Cyclohexanone, 5-methyl-2-(1-methylethylidene)-, (theta)-;(5R)-5-methyl-2-(propan-2-ylidene)cyclohexanone |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.2334 |
| InChl | InChI=1/C10H16O/c1-7(2)9-5-4-8(3)6-10(9)11/h8H,4-6H2,1-3H3/t8-/m1/s1 |
| CAS Registry Number | 89-82-7 |
| EINECS | 201-943-2 |
| Molecular Structure | ![]() |
| Density | 0.923g/cm3 |
| Boiling Point | 224°C at 760 mmHg |
| Refractive Index | 1.469 |
| Flash Point | 92.5°C |
| Vapour Pressur | 0.0934mmHg at 25°C |
| MSDS | |