90-11-9 1-Bromonaphthalene |
| Product Name |
1-Bromonaphthalene |
| Synonyms |
1-bromo-naphthalen;1-naphthyl bromide;1-naphthylbromide;i-bromnaphthalin;naphthalene,1-bromo-;α-bromonaphthalene;a-bromonaphthalene;1-bromo napthalene;1-bromonaphtalene;1-Bremnaphthalene |
| Molecular Formula |
C10H7Br |
| Molecular Weight |
207.0666 |
| InChl |
InChI=1/C10H7Br/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H |
| CAS Registry Number |
90-11-9 |
| EINECS |
201-965-2 |
| Molecular Structure |
 |
| Density |
1.481g/cm3 |
| Melting Point |
-1℃ |
| Boiling Point |
282.7°C at 760 mmHg |
| Refractive Index |
1.663 |
| Flash Point |
127.8°C |
| Water Solubility |
slightly soluble |
| Vapour Pressur |
0.00565mmHg at 25°C |
| Hazard Symbols |
 Xn##Harmful:;
|
| Risk Codes |
R22:;
|
| Safety Description |
S24/25##Avoid contact with skin and eyes.:;
|
