ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
90-11-9 1-Bromonaphthalene |
|
| Chemical Name | 1-Bromonaphthalene |
| Synonyms | 1-bromo-naphthalen;1-naphthyl bromide;1-naphthylbromide;i-bromnaphthalin;naphthalene,1-bromo-;α-bromonaphthalene;a-bromonaphthalene;1-bromo napthalene;1-bromonaphtalene;1-Bremnaphthalene |
| Molecular Formula | C10H7Br |
| Molecular Weight | 207.0666 |
| InChl | InChI=1/C10H7Br/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H |
| CAS Registry Number | 90-11-9 |
| EINECS | 201-965-2 |
| Molecular Structure | ![]() |
| Density | 1.481g/cm3 |
| Melting Point | -1℃ |
| Boiling Point | 282.7°C at 760 mmHg |
| Refractive Index | 1.663 |
| Flash Point | 127.8°C |
| Water Solubility | slightly soluble |
| Vapour Pressur | 0.00565mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R22:; |
| Safety Description | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |