90556-79-9 1-(3-Methoxybenzyl)-2-thiourea |
|
| Product Name | 1-(3-Methoxybenzyl)-2-thiourea |
| Synonyms | 1-(3-methoxybenzyl)thiourea |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.2694 |
| InChl | InChI=1/C9H12N2OS/c1-12-8-4-2-3-7(5-8)6-11-9(10)13/h2-5H,6H2,1H3,(H3,10,11,13) |
| CAS Registry Number | 90556-79-9 |
| Molecular Structure |  |
| Density | 1.198g/cm3 |
| Boiling Point | 344°C at 760 mmHg |
| Refractive Index | 1.611 |
| Flash Point | 161.8°C |
| Vapour Pressur | 6.78E-05mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
