ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
910036-91-8 3-[(4-methyl-1,4-diazepan-1-yl)methyl]benzonitrile |
|
| Chemical Name | 3-[(4-methyl-1,4-diazepan-1-yl)methyl]benzonitrile |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.3208 |
| InChl | InChI=1/C14H19N3/c1-16-6-3-7-17(9-8-16)12-14-5-2-4-13(10-14)11-15/h2,4-5,10H,3,6-9,12H2,1H3 |
| CAS Registry Number | 910036-91-8 |
| Molecular Structure | ![]() |
| Density | 1.09g/cm3 |
| Boiling Point | 344.7°C at 760 mmHg |
| Refractive Index | 1.578 |
| Flash Point | 142.3°C |
| Vapour Pressur | 6.46E-05mmHg at 25°C |
| MSDS | |