ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
93814-29-0 N~2~-acetyl-N,N-dimethyl-N~2~-[4-(3-methylbutoxy)phenyl]glycinamide |
|
| Chemical Name | N~2~-acetyl-N,N-dimethyl-N~2~-[4-(3-methylbutoxy)phenyl]glycinamide |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.3999 |
| InChl | InChI=1/C17H26N2O3/c1-13(2)10-11-22-16-8-6-15(7-9-16)19(14(3)20)12-17(21)18(4)5/h6-9,13H,10-12H2,1-5H3 |
| CAS Registry Number | 93814-29-0 |
| Molecular Structure | ![]() |
| Density | 1.073g/cm3 |
| Boiling Point | 452.7°C at 760 mmHg |
| Refractive Index | 1.529 |
| Flash Point | 227.6°C |
| Vapour Pressur | 2.2E-08mmHg at 25°C |
| MSDS | |