94-46-2 isopentyl benzoate |
| Product Name |
isopentyl benzoate |
| Synonyms |
Benzoic acid isoamyl ester;3-methyl-1-butanol benzoate;benzoic acid isopentyl ester;Isoamyl Benzoate;3-methylbutyl benzoate |
| Molecular Formula |
C12H16O2 |
| Molecular Weight |
192.2542 |
| InChl |
InChI=1/C12H16O2/c1-10(2)8-9-14-12(13)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
| CAS Registry Number |
94-46-2 |
| EINECS |
202-334-4 |
| Molecular Structure |
 |
| Density |
0.992g/cm3 |
| Boiling Point |
260°C at 760 mmHg |
| Refractive Index |
1.495 |
| Flash Point |
109.4°C |
| Vapour Pressur |
0.0125mmHg at 25°C |
| Safety Description |
S24/25##Avoid contact with skin and eyes.:;
|
