ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
97562-00-0 5-(2-fluorobenzyl)-3-methylpyrrolidin-2-one |
|
| Chemical Name | 5-(2-fluorobenzyl)-3-methylpyrrolidin-2-one |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.2441 |
| InChl | InChI=1/C12H14FNO/c1-8-6-10(14-12(8)15)7-9-4-2-3-5-11(9)13/h2-5,8,10H,6-7H2,1H3,(H,14,15) |
| CAS Registry Number | 97562-00-0 |
| Molecular Structure | ![]() |
| Density | 1.127g/cm3 |
| Boiling Point | 362.8°C at 760 mmHg |
| Refractive Index | 1.519 |
| Flash Point | 173.2°C |
| Vapour Pressur | 1.88E-05mmHg at 25°C |
| MSDS | |