97692-46-1 1-(3-methoxyphenyl)tridecane-1-carbonitrile |
|
| Product Name | 1-(3-methoxyphenyl)tridecane-1-carbonitrile |
| Synonyms | 1-(3-Methoxyphenyl)tridecane-1-carbonitrile;2-(3-methoxyphenyl)tetradecanenitrile |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.4928 |
| InChl | InChI=1/C21H33NO/c1-3-4-5-6-7-8-9-10-11-12-14-20(18-22)19-15-13-16-21(17-19)23-2/h13,15-17,20H,3-12,14H2,1-2H3 |
| CAS Registry Number | 97692-46-1 |
| EINECS | 307-699-4 |
| Molecular Structure |  |
| Density | 0.932g/cm3 |
| Boiling Point | 432.9°C at 760 mmHg |
| Refractive Index | 1.49 |
| Flash Point | 181.2°C |
| Vapour Pressur | 1.07E-07mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
