ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
99-14-9 Tricarballylic acid |
|
| Chemical Name | Tricarballylic acid |
| Synonyms | 1,2,3-Propanetricarboxylic acid;3-Carboxyglutaric acid;1,2,3-Propanetricarboxylic acid;propane-1,2,3-tricarboxylic acid |
| Molecular Formula | C6H8O6 |
| Molecular Weight | 176.1241 |
| InChl | InChI=1/C6H8O6/c7-4(8)1-3(6(11)12)2-5(9)10/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| CAS Registry Number | 99-14-9 |
| EINECS | 202-733-3 |
| Molecular Structure | ![]() |
| Density | 1.574g/cm3 |
| Melting Point | 154-159℃ |
| Boiling Point | 266.4°C at 760 mmHg |
| Refractive Index | 1.529 |
| Flash Point | 129.2°C |
| Vapour Pressur | 0.00249mmHg at 25°C |
| Safety Description | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |