ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
10401-11-3 3-Hydroxyphenylacetylene |
|
Produkt-Name | 3-Hydroxyphenylacetylene |
Englischer Name | 3-Hydroxyphenylacetylene;3-Ethynylphenol |
Molekulare Formel | C8H6O |
Molecular Weight | 118.1326 |
InChl | InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
CAS Registry Number | 10401-11-3 |
Molecular Structure | ![]() |
Dichte | 1.12g/cm3 |
Siedepunkt | 230.9°C at 760 mmHg |
Brechungsindex | 1.589 |
Flammpunkt | 106.1°C |
Dampfdruck | 0.0424mmHg at 25°C |
Risk Codes | R36/38##Irritating to eyes and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |