ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
119237-63-7 10-(3',5'-dimethylphenyl)-3-methylflavin |
|
| Produkt-Name | 10-(3',5'-dimethylphenyl)-3-methylflavin |
| Synonyme | 10-(3',5'-Dimethylphenyl)-3-methylflavin; 10-DMPMF; Benzo(g)pteridin-2,4(3H,10H)-dion, 10-(3,5-dimethylphenyl)-3,7,8-trimethyl-; 10-(3,5-dimethylphenyl)-3,7,8-trimethylbenzo[g]pteridin-2,4(3H,10H)-dion; |
| Englischer Name | 10-(3',5'-dimethylphenyl)-3-methylflavin;10-(3',5'-Dimethylphenyl)-3-methylflavin;10-Dmpmf;Benzo(g)pteridine-2,4(3H,10H)-dione, 10-(3,5-dimethylphenyl)-3,7,8-trimethyl-;10-(3,5-dimethylphenyl)-3,7,8-trimethylbenzo[g]pteridine-2,4(3H,10H)-dione |
| Molekulare Formel | C21H20N4O2 |
| Molecular Weight | 360.4091 |
| InChl | InChI=1/C21H20N4O2/c1-11-6-12(2)8-15(7-11)25-17-10-14(4)13(3)9-16(17)22-18-19(25)23-21(27)24(5)20(18)26/h6-10H,1-5H3 |
| CAS Registry Number | 119237-63-7 |
| Molecular Structure | ![]() |
| Dichte | 1.29g/cm3 |
| Siedepunkt | 540.9°C at 760 mmHg |
| Brechungsindex | 1.671 |
| Flammpunkt | 280.9°C |
| Dampfdruck | 9.17E-12mmHg at 25°C |
| MSDS | |