ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1444-65-1 2-Phenylcyclohexanone |
|
Produkt-Name | 2-Phenylcyclohexanone |
Englischer Name | 2-Phenylcyclohexanone;AI3-07036;Cyclohexanone, 2-phenyl-;(2S)-2-phenylcyclohexanone;(2R)-2-phenylcyclohexanone |
Molekulare Formel | C12H14O |
Molecular Weight | 174.239 |
InChl | InChI=1/C12H14O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2/t11-/m1/s1 |
CAS Registry Number | 1444-65-1 |
EINECS | 215-888-7 |
Molecular Structure | ![]() |
Dichte | 1.042g/cm3 |
Schmelzpunkt | 56-59℃ |
Siedepunkt | 294°C at 760 mmHg |
Brechungsindex | 1.537 |
Flammpunkt | 123.7°C |
Dampfdruck | 0.00167mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |