ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1565-81-7 3-Decanol |
|
Produkt-Name | 3-Decanol |
Englischer Name | 3-Decanol;Ethyl n-heptyl carbinol;decan-3-ol |
Molekulare Formel | C10H22O |
Molecular Weight | 158.2811 |
InChl | InChI=1/C10H22O/c1-3-5-6-7-8-9-10(11)4-2/h10-11H,3-9H2,1-2H3 |
CAS Registry Number | 1565-81-7 |
Molecular Structure | ![]() |
Dichte | 0.826g/cm3 |
Siedepunkt | 213.4°C at 760 mmHg |
Brechungsindex | 1.434 |
Flammpunkt | 87.1°C |
Dampfdruck | 0.0365mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |