ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
15822-77-2 1-(2-nitrophenyl)piperidine |
|
Produkt-Name | 1-(2-nitrophenyl)piperidine |
Englischer Name | 1-(2-nitrophenyl)piperidine;1-(2-Nitrophenyl)piperidine;1-(O-Nitrophenyl)piperidine;Piperidine, 1-(2-nitrophenyl)- |
Molekulare Formel | C11H14N2O2 |
Molecular Weight | 206.2411 |
InChl | InChI=1/C11H14N2O2/c14-13(15)11-7-3-2-6-10(11)12-8-4-1-5-9-12/h2-3,6-7H,1,4-5,8-9H2 |
CAS Registry Number | 15822-77-2 |
Molecular Structure | ![]() |
Dichte | 1.188g/cm3 |
Schmelzpunkt | 77℃ |
Siedepunkt | 337.7°C at 760 mmHg |
Brechungsindex | 1.578 |
Flammpunkt | 158°C |
Dampfdruck | 0.000103mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |