Chemindex > 17351-75-6
DE ▼
17351-75-6 Divinyloxy 1,4-cyclohexanedimethanol |
|
| Produkt-Name | Divinyloxy 1,4-cyclohexanedimethanol |
| Englischer Name | Divinyloxy 1,4-cyclohexanedimethanol;1,4-Cyclohexanedimethanol divinyl ether,mixture of isomers;1,4-bis(prop-1-en-1-yloxy)cyclohexane;3,5-bis(1-methylethyl)-1H-pyrazole;1,4-Cyclohexan dimethanol divinyl ether |
| Molekulare Formel | C9H16N2 |
| Molecular Weight | 152.2367 |
| InChl | InChI=1/C9H16N2/c1-6(2)8-5-9(7(3)4)11-10-8/h5-7H,1-4H3,(H,10,11) |
| CAS Registry Number | 17351-75-6 |
| Molecular Structure |  |
| Dichte | 0.944g/cm3 |
| Schmelzpunkt | 6℃ |
| Siedepunkt | 237.3°C at 760 mmHg |
| Brechungsindex | 1.496 |
| Flammpunkt | 91.4°C |
| Dampfdruck | 0.0696mmHg at 25°C |
| Gefahrensymbole |  Xi##Irritant||N##Dangerous for the environment:; |
| Risk Codes | R43||R51/53:; |
| Safety Beschreibung | S24||S37||S61:; |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 