ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1774-66-9 (2E)-3-(4-bromphenyl)-1-phenylprop-2-en-1-on |
|
| Produkt-Name | (2E)-3-(4-bromphenyl)-1-phenylprop-2-en-1-on |
| Synonyme | ;(2E)-3-(4-Bromphenyl)-1-phenyl-2-propen-1-on; 2-Propen-1-on, 3-(4-Bromphenyl)-1-phenyl-; 2-Propen-1-on, 3-(4-bromphenyl)-1-phenyl-; 2-Propen-1-on, 3-(4-bromophenyl)-1-phenyl-, (2E)-; 2-Propen-1-on, 3-(4-bromphenyl)-1-phenyl-, (E)-; trans-4-Bromochalcon; |
| Englischer Name | (2E)-3-(4-bromophenyl)-1-phenylprop-2-en-1-one;(2E)-3-(4-Bromophenyl)-1-phenyl-2-propen-1-one;2-Propen-1-one, 3- (4-bromophenyl)-1-phenyl-;2-Propen-1-one, 3-(4-bromophenyl)-1-phenyl-;2-propen-1-one, 3-(4-bromophenyl)-1-phenyl-, (2E)-;2-Propen-1-one, 3-(4-bromophenyl)-1-phenyl-, (E)-;trans-4-Bromochalcone |
| Molekulare Formel | C15H11BrO |
| Molecular Weight | 287.1512 |
| InChl | InChI=1/C15H11BrO/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11H/b11-8+ |
| CAS Registry Number | 1774-66-9;22966-09-2 |
| Molecular Structure | ![]() |
| Dichte | 1.393g/cm3 |
| Siedepunkt | 398.3°C at 760 mmHg |
| Brechungsindex | 1.646 |
| Flammpunkt | 79.6°C |
| Dampfdruck | 1.49E-06mmHg at 25°C |
| MSDS | |