ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
20028-53-9 2-Amino-5-chlorobenzaldehyde |
|
Produkt-Name | 2-Amino-5-chlorobenzaldehyde |
Englischer Name | 2-Amino-5-chlorobenzaldehyde;6-Amino-3-chlorobenzaldehyde |
Molekulare Formel | C7H6ClNO |
Molecular Weight | 155.5816 |
InChl | InChI=1/C7H6ClNO/c8-6-1-2-7(9)5(3-6)4-10/h1-4H,9H2 |
CAS Registry Number | 20028-53-9 |
Molecular Structure | ![]() |
Dichte | 1.348g/cm3 |
Siedepunkt | 288.1°C at 760 mmHg |
Brechungsindex | 1.651 |
Flammpunkt | 128°C |
Dampfdruck | 0.00239mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |