ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
20129-60-6 2,5-dihydroxy-3,6-dioxocyclohexa-1,4-diene-1,4-diyl dipropanoate |
|
| Produkt-Name | 2,5-dihydroxy-3,6-dioxocyclohexa-1,4-diene-1,4-diyl dipropanoate |
| Englischer Name | 2,5-dihydroxy-3,6-dioxocyclohexa-1,4-diene-1,4-diyl dipropanoate; |
| Molekulare Formel | C12H12O8 |
| Molecular Weight | 284.2189 |
| InChl | InChI=1/C12H12O8/c1-3-5(13)19-11-7(15)9(17)12(10(18)8(11)16)20-6(14)4-2/h15,18H,3-4H2,1-2H3 |
| CAS Registry Number | 20129-60-6 |
| Molecular Structure | ![]() |
| Dichte | 1.49g/cm3 |
| Siedepunkt | 420.7°C at 760 mmHg |
| Brechungsindex | 1.561 |
| Flammpunkt | 158.7°C |
| Dampfdruck | 7.74E-09mmHg at 25°C |
| MSDS | |