ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
203808-44-0 (3-Benzyl-5,6-dimethyl-2,4-dioxo-3,4-dihydrothieno[2,3-d]pyrimidin-1(2H)-yl)essigsäure |
|
| Produkt-Name | (3-Benzyl-5,6-dimethyl-2,4-dioxo-3,4-dihydrothieno[2,3-d]pyrimidin-1(2H)-yl)essigsäure |
| Synonyme | ; |
| Englischer Name | (3-benzyl-5,6-dimethyl-2,4-dioxo-3,4-dihydrothieno[2,3-d]pyrimidin-1(2H)-yl)acetic acid; |
| Molekulare Formel | C17H16N2O4S |
| Molecular Weight | 344.3849 |
| InChl | InChI=1/C17H16N2O4S/c1-10-11(2)24-16-14(10)15(22)18(8-12-6-4-3-5-7-12)17(23)19(16)9-13(20)21/h3-7H,8-9H2,1-2H3,(H,20,21) |
| CAS Registry Number | 203808-44-0 |
| Molecular Structure | ![]() |
| Dichte | 1.411g/cm3 |
| Siedepunkt | 596.7°C at 760 mmHg |
| Brechungsindex | 1.653 |
| Flammpunkt | 314.7°C |
| Dampfdruck | 4.35E-15mmHg at 25°C |
| MSDS | |