Chemindex > 20475-12-1
DE ▼
20475-12-1 Tris(2-hydroxyethyl)ammoniumlactat |
|
| Produkt-Name | Tris(2-hydroxyethyl)ammoniumlactat |
| Synonyme | Milchsäure, vereinigt mit 2,2',2''-Nitrilotri(ethanol) (1:1); TEE-Laktat; Triethanolamin-Lactat; Propansäure, 2-Hydroxy-, komp.mit 2,2',2''-Nitrilotris(ethanol) (1:1); Tris(2-hydroxyethyl)ammoniumlactat; 2-Hydroxypropansäure-2,2',2''-Nitrilotriethanol (1:1); |
| Englischer Name | tris(2-hydroxyethyl)ammonium lactate;Lactic acid, compd. with 2,2',2''-nitrilotri(ethanol) (1:1);TEA-Lactate;Triethanolamine lactate;Propanoic acid, 2-hydroxy-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);Tris(2-hydroxyethyl)ammonium lactate;2-hydroxypropanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
| Molekulare Formel | C9H21NO6 |
| Molecular Weight | 239.2661 |
| InChl | InChI=1/C6H15NO3.C3H6O3/c8-4-1-7(2-5-9)3-6-10;1-2(4)3(5)6/h8-10H,1-6H2;2,4H,1H3,(H,5,6) |
| CAS Registry Number | 20475-12-1 |
| EINECS | 243-846-8 |
| Molecular Structure |  |
| Siedepunkt | 335.4°C at 760 mmHg |
| Flammpunkt | 185°C |
| Dampfdruck | 8.38E-06mmHg at 25°C |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Lieferanten für 20475-12-1 (0):
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 