ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
205-97-0 Naphtho[2,3-e]acephenanthrylen |
|
| Produkt-Name | Naphtho[2,3-e]acephenanthrylen |
| Synonyme | ; Naphth[2,3-e]acephenanthrylen; |
| Englischer Name | naphtho[2,3-e]acephenanthrylene;naphth[2,3-e]acephenanthrylene |
| Molekulare Formel | C24H14 |
| Molecular Weight | 302.368 |
| InChl | InChI=1/C24H14/c1-2-7-16-13-22-21(12-15(16)6-1)20-11-5-10-19-18-9-4-3-8-17(18)14-23(22)24(19)20/h1-14H |
| CAS Registry Number | 205-97-0;60382-88-9 |
| Molecular Structure | ![]() |
| Dichte | 1.313g/cm3 |
| Siedepunkt | 552.3°C at 760 mmHg |
| Brechungsindex | 1.912 |
| Flammpunkt | 282°C |
| Dampfdruck | 1.12E-11mmHg at 25°C |
| MSDS | |