ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
21239-29-2 Ethyl 3,5-dimethylbenzoate |
|
Produkt-Name | Ethyl 3,5-dimethylbenzoate |
Englischer Name | Ethyl 3,5-dimethylbenzoate;3,5-Dimethylbenzoic acid ethyl ester |
Molekulare Formel | C11H14O2 |
Molecular Weight | 178.2277 |
InChl | InChI=1/C11H14O2/c1-4-13-11(12)10-6-8(2)5-9(3)7-10/h5-7H,4H2,1-3H3 |
CAS Registry Number | 21239-29-2 |
EINECS | 244-286-7 |
Molecular Structure | ![]() |
Dichte | 1.01g/cm3 |
Siedepunkt | 260.9°C at 760 mmHg |
Brechungsindex | 1.504 |
Flammpunkt | 115.4°C |
Dampfdruck | 0.0119mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |