ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216393-65-6 1-n-Butyl-4-(ethylthio)benzene |
|
| Produkt-Name | 1-n-Butyl-4-(ethylthio)benzene |
| Englischer Name | 1-n-Butyl-4-(ethylthio)benzene;4-(Ethylthio)-n-butylbenzene;1-butyl-4-(ethylsulfanyl)benzene |
| Molekulare Formel | C12H18S |
| Molecular Weight | 194.3363 |
| InChl | InChI=1/C12H18S/c1-3-5-6-11-7-9-12(10-8-11)13-4-2/h7-10H,3-6H2,1-2H3 |
| CAS Registry Number | 216393-65-6 |
| Molecular Structure | ![]() |
| Dichte | 0.96g/cm3 |
| Siedepunkt | 279.6°C at 760 mmHg |
| Brechungsindex | 1.53 |
| Flammpunkt | 119.8°C |
| Dampfdruck | 0.00675mmHg at 25°C |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |